C29H34N4O6S — CID 46110555
1-[4-[(3,5-dimethoxybenzoyl)amino]-2-(1-phenylethylsulfamoyl)phenyl]piperidine-4-carboxamide (PubChem CID 46110555) has the molecular formula C29H34N4O6S and a molecular weight of 566.68 g/mol. Its IUPAC name is 1-[4-[(3,5-dimethoxybenzoyl)amino]-2-(1-phenylethylsulfamoyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[(3,5-dimethoxybenzoyl)amino]-2-(1-phenylethylsulfamoyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46110555 |
| Molecular Formula | C29H34N4O6S |
| Molecular Weight | 566.68 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 1-[4-[(3,5-dimethoxybenzoyl)amino]-2-(1-phenylethylsulfamoyl)phenyl]piperidine-4-carboxamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(N3CCC(C(N)=O)CC3)c(S(=O)(=O)NC(C)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C29H34N4O6S/c1-19(20-7-5-4-6-8-20)32-40(36,37)27-17-23(9-10-26(27)33-13-11-21(12-14-33)28(30)34)31-29(35)22-15-24(38-2)18-25(16-22)39-3/h4-10,15-19,21,32H,11-14H2,1-3H3,(H2,30,34)(H,31,35) |
| InChIKey | QOIJODHMVUPNDE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.68 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|