C29H33N3O5S — CID 98423821
3,5-dimethoxy-N-[4-pyrrolidin-1-yl-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]benzamide (PubChem CID 98423821) has the molecular formula C29H33N3O5S and a molecular weight of 535.67 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[4-pyrrolidin-1-yl-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[4-pyrrolidin-1-yl-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 98423821 |
| Molecular Formula | C29H33N3O5S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | 3,5-dimethoxy-N-[4-pyrrolidin-1-yl-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(N3CCCC3)c(S(=O)(=O)N[C@H]3CCCc4ccccc43)c2)c1 |
| InChI | InChI=1S/C29H33N3O5S/c1-36-23-16-21(17-24(19-23)37-2)29(33)30-22-12-13-27(32-14-5-6-15-32)28(18-22)38(34,35)31-26-11-7-9-20-8-3-4-10-25(20)26/h3-4,8,10,12-13,16-19,26,31H,5-7,9,11,14-15H2,1-2H3,(H,30,33)/t26-/m0/s1 |
| InChIKey | MDMMAXDFSKVTTR-SANMLTNESA-N |
| XLogP | 4.91 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|