C27H38N4O3S — CID 93018768
N-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]-2,2-dimethylpropanamide (PubChem CID 93018768) has the molecular formula C27H38N4O3S and a molecular weight of 498.69 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 93018768 |
| Molecular Formula | C27H38N4O3S |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]-2,2-dimethylpropanamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)C(C)(C)C)cc2S(=O)(=O)N[C@@H]2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C27H38N4O3S/c1-5-30-15-17-31(18-16-30)24-14-13-21(28-26(32)27(2,3)4)19-25(24)35(33,34)29-23-12-8-10-20-9-6-7-11-22(20)23/h6-7,9,11,13-14,19,23,29H,5,8,10,12,15-18H2,1-4H3,(H,28,32)/t23-/m1/s1 |
| InChIKey | NDGPVDPZUZRJNO-HSZRJFAPSA-N |
| XLogP | 4.17 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|