C30H35N3O3S — CID 46110245
2-phenyl-N-[4-pyrrolidin-1-yl-3-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoyl)phenyl]butanamide (PubChem CID 46110245) has the molecular formula C30H35N3O3S and a molecular weight of 517.70 g/mol. Its IUPAC name is 2-phenyl-N-[4-pyrrolidin-1-yl-3-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoyl)phenyl]butanamide.
| Compound Name | 2-phenyl-N-[4-pyrrolidin-1-yl-3-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoyl)phenyl]butanamide |
|---|---|
| PubChem CID | 46110245 |
| Molecular Formula | C30H35N3O3S |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 2-phenyl-N-[4-pyrrolidin-1-yl-3-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoyl)phenyl]butanamide |
| SMILES | CCC(C(=O)Nc1ccc(N2CCCC2)c(S(=O)(=O)NC2CCCc3ccccc32)c1)c1ccccc1 |
| InChI | InChI=1S/C30H35N3O3S/c1-2-25(22-11-4-3-5-12-22)30(34)31-24-17-18-28(33-19-8-9-20-33)29(21-24)37(35,36)32-27-16-10-14-23-13-6-7-15-26(23)27/h3-7,11-13,15,17-18,21,25,27,32H,2,8-10,14,16,19-20H2,1H3,(H,31,34) |
| InChIKey | MEZRCWGWYBYFRF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|