C28H40N4O3S — CID 93018784
N-[4-(4-ethylpiperazin-1-yl)-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]hexanamide (PubChem CID 93018784) has the molecular formula C28H40N4O3S and a molecular weight of 512.72 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]hexanamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]hexanamide |
|---|---|
| PubChem CID | 93018784 |
| Molecular Formula | C28H40N4O3S |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]hexanamide |
| SMILES | CCCCCC(=O)Nc1ccc(N2CCN(CC)CC2)c(S(=O)(=O)N[C@H]2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C28H40N4O3S/c1-3-5-6-14-28(33)29-23-15-16-26(32-19-17-31(4-2)18-20-32)27(21-23)36(34,35)30-25-13-9-11-22-10-7-8-12-24(22)25/h7-8,10,12,15-16,21,25,30H,3-6,9,11,13-14,17-20H2,1-2H3,(H,29,33)/t25-/m0/s1 |
| InChIKey | CPOXAFMVHNAMIV-VWLOTQADSA-N |
| XLogP | 4.70 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|