C29H33BrN4O3S — CID 98259292
3-bromo-N-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]benzamide (PubChem CID 98259292) has the molecular formula C29H33BrN4O3S and a molecular weight of 597.58 g/mol. Its IUPAC name is 3-bromo-N-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]benzamide.
| Compound Name | 3-bromo-N-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 98259292 |
| Molecular Formula | C29H33BrN4O3S |
| Molecular Weight | 597.58 g/mol |
| Exact Mass | 596.15 |
| IUPAC Name | 3-bromo-N-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]benzamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3cccc(Br)c3)cc2S(=O)(=O)N[C@@H]2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C29H33BrN4O3S/c1-2-33-15-17-34(18-16-33)27-14-13-24(31-29(35)22-9-5-10-23(30)19-22)20-28(27)38(36,37)32-26-12-6-8-21-7-3-4-11-25(21)26/h3-5,7,9-11,13-14,19-20,26,32H,2,6,8,12,15-18H2,1H3,(H,31,35)/t26-/m1/s1 |
| InChIKey | DRAZOBAZXNIPOI-AREMUKBSSA-N |
| XLogP | 5.20 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|