C31H41N3O5S — CID 98410185
ethyl 1-[4-(cyclohexanecarbonylamino)-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]piperidine-4-carboxylate (PubChem CID 98410185) has the molecular formula C31H41N3O5S and a molecular weight of 567.75 g/mol. Its IUPAC name is ethyl 1-[4-(cyclohexanecarbonylamino)-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-(cyclohexanecarbonylamino)-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 98410185 |
| Molecular Formula | C31H41N3O5S |
| Molecular Weight | 567.75 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | ethyl 1-[4-(cyclohexanecarbonylamino)-2-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc(NC(=O)C3CCCCC3)cc2S(=O)(=O)N[C@H]2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C31H41N3O5S/c1-2-39-31(36)24-17-19-34(20-18-24)28-16-15-25(32-30(35)23-10-4-3-5-11-23)21-29(28)40(37,38)33-27-14-8-12-22-9-6-7-13-26(22)27/h6-7,9,13,15-16,21,23-24,27,33H,2-5,8,10-12,14,17-20H2,1H3,(H,32,35)/t27-/m0/s1 |
| InChIKey | ZDTWPSKUFVKWHF-MHZLTWQESA-N |
| XLogP | 5.34 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.75 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|