C24H30ClN3O3S — CID 93018681
4-chloro-N-[4-pyrrolidin-1-yl-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]butanamide (PubChem CID 93018681) has the molecular formula C24H30ClN3O3S and a molecular weight of 476.04 g/mol. Its IUPAC name is 4-chloro-N-[4-pyrrolidin-1-yl-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]butanamide.
| Compound Name | 4-chloro-N-[4-pyrrolidin-1-yl-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]butanamide |
|---|---|
| PubChem CID | 93018681 |
| Molecular Formula | C24H30ClN3O3S |
| Molecular Weight | 476.04 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 4-chloro-N-[4-pyrrolidin-1-yl-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]butanamide |
| SMILES | O=C(CCCCl)Nc1ccc(N2CCCC2)c(S(=O)(=O)N[C@@H]2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C24H30ClN3O3S/c25-14-6-11-24(29)26-19-12-13-22(28-15-3-4-16-28)23(17-19)32(30,31)27-21-10-5-8-18-7-1-2-9-20(18)21/h1-2,7,9,12-13,17,21,27H,3-6,8,10-11,14-16H2,(H,26,29)/t21-/m1/s1 |
| InChIKey | WFEZFJUZQWKUAC-OAQYLSRUSA-N |
| XLogP | 4.60 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.04 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|