C31H38N4O4S — CID 98197865
N-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]-2-(4-methoxyphenyl)acetamide (PubChem CID 98197865) has the molecular formula C31H38N4O4S and a molecular weight of 562.74 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 98197865 |
| Molecular Formula | C31H38N4O4S |
| Molecular Weight | 562.74 g/mol |
| Exact Mass | 562.26 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-3-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]-2-(4-methoxyphenyl)acetamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)Cc3ccc(OC)cc3)cc2S(=O)(=O)N[C@@H]2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C31H38N4O4S/c1-3-34-17-19-35(20-18-34)29-16-13-25(32-31(36)21-23-11-14-26(39-2)15-12-23)22-30(29)40(37,38)33-28-10-6-8-24-7-4-5-9-27(24)28/h4-5,7,9,11-16,22,28,33H,3,6,8,10,17-21H2,1-2H3,(H,32,36)/t28-/m1/s1 |
| InChIKey | BBGPEVDJEDQMMA-MUUNZHRXSA-N |
| XLogP | 4.37 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.74 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|