C26H36N4O3S — CID 93018776
N-[4-(4-ethylpiperazin-1-yl)-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]-2-methylpropanamide (PubChem CID 93018776) has the molecular formula C26H36N4O3S and a molecular weight of 484.67 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]-2-methylpropanamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 93018776 |
| Molecular Formula | C26H36N4O3S |
| Molecular Weight | 484.67 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)-3-[[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]-2-methylpropanamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)C(C)C)cc2S(=O)(=O)N[C@H]2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C26H36N4O3S/c1-4-29-14-16-30(17-15-29)24-13-12-21(27-26(31)19(2)3)18-25(24)34(32,33)28-23-11-7-9-20-8-5-6-10-22(20)23/h5-6,8,10,12-13,18-19,23,28H,4,7,9,11,14-17H2,1-3H3,(H,27,31)/t23-/m0/s1 |
| InChIKey | XDEKVTQTPNZHKC-QHCPKHFHSA-N |
| XLogP | 3.78 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.67 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|