C26H35N3O6S2 — CID 46110600
ethyl 1-[4-(ethylsulfonylamino)-2-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoyl)phenyl]piperidine-4-carboxylate (PubChem CID 46110600) has the molecular formula C26H35N3O6S2 and a molecular weight of 549.72 g/mol. Its IUPAC name is ethyl 1-[4-(ethylsulfonylamino)-2-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoyl)phenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-(ethylsulfonylamino)-2-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoyl)phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46110600 |
| Molecular Formula | C26H35N3O6S2 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | ethyl 1-[4-(ethylsulfonylamino)-2-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoyl)phenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc(NS(=O)(=O)CC)cc2S(=O)(=O)NC2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C26H35N3O6S2/c1-3-35-26(30)20-14-16-29(17-15-20)24-13-12-21(27-36(31,32)4-2)18-25(24)37(33,34)28-23-11-7-9-19-8-5-6-10-22(19)23/h5-6,8,10,12-13,18,20,23,27-28H,3-4,7,9,11,14-17H2,1-2H3 |
| InChIKey | UHMBPUQUSFKWRI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|