C32H37N3O6S — CID 46110443
ethyl 1-[4-[(3-methoxybenzoyl)amino]-2-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoyl)phenyl]piperidine-4-carboxylate (PubChem CID 46110443) has the molecular formula C32H37N3O6S and a molecular weight of 591.73 g/mol. Its IUPAC name is ethyl 1-[4-[(3-methoxybenzoyl)amino]-2-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoyl)phenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[(3-methoxybenzoyl)amino]-2-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoyl)phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46110443 |
| Molecular Formula | C32H37N3O6S |
| Molecular Weight | 591.73 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | ethyl 1-[4-[(3-methoxybenzoyl)amino]-2-(1,2,3,4-tetrahydronaphthalen-1-ylsulfamoyl)phenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc(NC(=O)c3cccc(OC)c3)cc2S(=O)(=O)NC2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C32H37N3O6S/c1-3-41-32(37)23-16-18-35(19-17-23)29-15-14-25(33-31(36)24-10-6-11-26(20-24)40-2)21-30(29)42(38,39)34-28-13-7-9-22-8-4-5-12-27(22)28/h4-6,8,10-12,14-15,20-21,23,28,34H,3,7,9,13,16-19H2,1-2H3,(H,33,36) |
| InChIKey | IHYHTYWCCXASBE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.73 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|