C32H37N3O5S — CID 98410178
ethyl 1-[4-[(2-methylbenzoyl)amino]-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]piperidine-4-carboxylate (PubChem CID 98410178) has the molecular formula C32H37N3O5S and a molecular weight of 575.73 g/mol. Its IUPAC name is ethyl 1-[4-[(2-methylbenzoyl)amino]-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[(2-methylbenzoyl)amino]-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 98410178 |
| Molecular Formula | C32H37N3O5S |
| Molecular Weight | 575.73 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | ethyl 1-[4-[(2-methylbenzoyl)amino]-2-[[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]sulfamoyl]phenyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ccc(NC(=O)c3ccccc3C)cc2S(=O)(=O)N[C@@H]2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C32H37N3O5S/c1-3-40-32(37)24-17-19-35(20-18-24)29-16-15-25(33-31(36)26-12-6-4-9-22(26)2)21-30(29)41(38,39)34-28-14-8-11-23-10-5-7-13-27(23)28/h4-7,9-10,12-13,15-16,21,24,28,34H,3,8,11,14,17-20H2,1-2H3,(H,33,36)/t28-/m1/s1 |
| InChIKey | VIQQLBKFELTQPR-MUUNZHRXSA-N |
| XLogP | 5.38 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.73 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|