C23H29FN4O4S — CID 93018883
1-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-[(2-fluorobenzoyl)amino]phenyl]piperidine-4-carboxamide (PubChem CID 93018883) has the molecular formula C23H29FN4O4S and a molecular weight of 476.57 g/mol. Its IUPAC name is 1-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-[(2-fluorobenzoyl)amino]phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-[(2-fluorobenzoyl)amino]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 93018883 |
| Molecular Formula | C23H29FN4O4S |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 1-[2-[[(2R)-butan-2-yl]sulfamoyl]-4-[(2-fluorobenzoyl)amino]phenyl]piperidine-4-carboxamide |
| SMILES | CC[C@@H](C)NS(=O)(=O)c1cc(NC(=O)c2ccccc2F)ccc1N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C23H29FN4O4S/c1-3-15(2)27-33(31,32)21-14-17(26-23(30)18-6-4-5-7-19(18)24)8-9-20(21)28-12-10-16(11-13-28)22(25)29/h4-9,14-16,27H,3,10-13H2,1-2H3,(H2,25,29)(H,26,30)/t15-/m1/s1 |
| InChIKey | SQRKZRSNFRNJBZ-OAHLLOKOSA-N |
| XLogP | 2.86 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|