C21H22FN3O5 — CID 46362977
2-(4-ethoxycarbonylpiperazin-1-yl)-5-[(2-fluorobenzoyl)amino]benzoic acid (PubChem CID 46362977) has the molecular formula C21H22FN3O5 and a molecular weight of 415.42 g/mol. Its IUPAC name is 2-(4-ethoxycarbonylpiperazin-1-yl)-5-[(2-fluorobenzoyl)amino]benzoic acid.
| Compound Name | 2-(4-ethoxycarbonylpiperazin-1-yl)-5-[(2-fluorobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 46362977 |
| Molecular Formula | C21H22FN3O5 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-(4-ethoxycarbonylpiperazin-1-yl)-5-[(2-fluorobenzoyl)amino]benzoic acid |
| SMILES | CCOC(=O)N1CCN(c2ccc(NC(=O)c3ccccc3F)cc2C(=O)O)CC1 |
| InChI | InChI=1S/C21H22FN3O5/c1-2-30-21(29)25-11-9-24(10-12-25)18-8-7-14(13-16(18)20(27)28)23-19(26)15-5-3-4-6-17(15)22/h3-8,13H,2,9-12H2,1H3,(H,23,26)(H,27,28) |
| InChIKey | ITEPKDKPUZPOLA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|