C24H28FN3O3 — CID 94083685
5-[(2-fluorobenzoyl)amino]-2-[(3S)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid (PubChem CID 94083685) has the molecular formula C24H28FN3O3 and a molecular weight of 425.50 g/mol. Its IUPAC name is 5-[(2-fluorobenzoyl)amino]-2-[(3S)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid.
| Compound Name | 5-[(2-fluorobenzoyl)amino]-2-[(3S)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 94083685 |
| Molecular Formula | C24H28FN3O3 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 5-[(2-fluorobenzoyl)amino]-2-[(3S)-3-(pyrrolidin-1-ylmethyl)piperidin-1-yl]benzoic acid |
| SMILES | O=C(Nc1ccc(N2CCC[C@@H](CN3CCCC3)C2)c(C(=O)O)c1)c1ccccc1F |
| InChI | InChI=1S/C24H28FN3O3/c25-21-8-2-1-7-19(21)23(29)26-18-9-10-22(20(14-18)24(30)31)28-13-5-6-17(16-28)15-27-11-3-4-12-27/h1-2,7-10,14,17H,3-6,11-13,15-16H2,(H,26,29)(H,30,31)/t17-/m0/s1 |
| InChIKey | QSZBCJLMMLFCSG-KRWDZBQOSA-N |
| XLogP | 4.09 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|