C20H21FN2O3 — CID 50807442
5-[(2-fluorobenzoyl)amino]-2-(3-methylpiperidin-1-yl)benzoic acid (PubChem CID 50807442) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is 5-[(2-fluorobenzoyl)amino]-2-(3-methylpiperidin-1-yl)benzoic acid.
| Compound Name | 5-[(2-fluorobenzoyl)amino]-2-(3-methylpiperidin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 50807442 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 5-[(2-fluorobenzoyl)amino]-2-(3-methylpiperidin-1-yl)benzoic acid |
| SMILES | CC1CCCN(c2ccc(NC(=O)c3ccccc3F)cc2C(=O)O)C1 |
| InChI | InChI=1S/C20H21FN2O3/c1-13-5-4-10-23(12-13)18-9-8-14(11-16(18)20(25)26)22-19(24)15-6-2-3-7-17(15)21/h2-3,6-9,11,13H,4-5,10,12H2,1H3,(H,22,24)(H,25,26) |
| InChIKey | DCXKICSINZJJDD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|