C20H21BrN2O3 — CID 94083663
5-[(4-bromobenzoyl)amino]-2-[(3S)-3-methylpiperidin-1-yl]benzoic acid (PubChem CID 94083663) has the molecular formula C20H21BrN2O3 and a molecular weight of 417.30 g/mol. Its IUPAC name is 5-[(4-bromobenzoyl)amino]-2-[(3S)-3-methylpiperidin-1-yl]benzoic acid.
| Compound Name | 5-[(4-bromobenzoyl)amino]-2-[(3S)-3-methylpiperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 94083663 |
| Molecular Formula | C20H21BrN2O3 |
| Molecular Weight | 417.30 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 5-[(4-bromobenzoyl)amino]-2-[(3S)-3-methylpiperidin-1-yl]benzoic acid |
| SMILES | C[C@H]1CCCN(c2ccc(NC(=O)c3ccc(Br)cc3)cc2C(=O)O)C1 |
| InChI | InChI=1S/C20H21BrN2O3/c1-13-3-2-10-23(12-13)18-9-8-16(11-17(18)20(25)26)22-19(24)14-4-6-15(21)7-5-14/h4-9,11,13H,2-3,10,12H2,1H3,(H,22,24)(H,25,26)/t13-/m0/s1 |
| InChIKey | NFRQXSCFLUWEIR-ZDUSSCGKSA-N |
| XLogP | 4.64 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.30 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|