C21H23ClN2O3 — CID 7179760
5-[(4-chlorobenzoyl)amino]-2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]benzoic acid (PubChem CID 7179760) has the molecular formula C21H23ClN2O3 and a molecular weight of 386.88 g/mol. Its IUPAC name is 5-[(4-chlorobenzoyl)amino]-2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]benzoic acid.
| Compound Name | 5-[(4-chlorobenzoyl)amino]-2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 7179760 |
| Molecular Formula | C21H23ClN2O3 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 5-[(4-chlorobenzoyl)amino]-2-[(3R,5R)-3,5-dimethylpiperidin-1-yl]benzoic acid |
| SMILES | C[C@@H]1C[C@@H](C)CN(c2ccc(NC(=O)c3ccc(Cl)cc3)cc2C(=O)O)C1 |
| InChI | InChI=1S/C21H23ClN2O3/c1-13-9-14(2)12-24(11-13)19-8-7-17(10-18(19)21(26)27)23-20(25)15-3-5-16(22)6-4-15/h3-8,10,13-14H,9,11-12H2,1-2H3,(H,23,25)(H,26,27)/t13-,14-/m1/s1 |
| InChIKey | FXCLRNVVRMSWSW-ZIAGYGMSSA-N |
| XLogP | 4.77 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|