C27H29N3O3 — CID 92877321
5-[(4-methylbenzoyl)amino]-2-[(3R)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]benzoic acid (PubChem CID 92877321) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 5-[(4-methylbenzoyl)amino]-2-[(3R)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]benzoic acid.
| Compound Name | 5-[(4-methylbenzoyl)amino]-2-[(3R)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 92877321 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 5-[(4-methylbenzoyl)amino]-2-[(3R)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]benzoic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCN(c4cccc(C)c4)[C@H](C)C3)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C27H29N3O3/c1-18-7-9-21(10-8-18)26(31)28-22-11-12-25(24(16-22)27(32)33)29-13-14-30(20(3)17-29)23-6-4-5-19(2)15-23/h4-12,15-16,20H,13-14,17H2,1-3H3,(H,28,31)(H,32,33)/t20-/m1/s1 |
| InChIKey | OXKODAINTCSIBH-HXUWFJFHSA-N |
| XLogP | 4.97 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|