C26H26FN3O3 — CID 95064015
3-[(4-fluorobenzoyl)amino]-4-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]benzoic acid (PubChem CID 95064015) has the molecular formula C26H26FN3O3 and a molecular weight of 447.51 g/mol. Its IUPAC name is 3-[(4-fluorobenzoyl)amino]-4-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]benzoic acid.
| Compound Name | 3-[(4-fluorobenzoyl)amino]-4-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 95064015 |
| Molecular Formula | C26H26FN3O3 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 3-[(4-fluorobenzoyl)amino]-4-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]benzoic acid |
| SMILES | Cc1cccc(N2CCN(c3ccc(C(=O)O)cc3NC(=O)c3ccc(F)cc3)C[C@@H]2C)c1 |
| InChI | InChI=1S/C26H26FN3O3/c1-17-4-3-5-22(14-17)30-13-12-29(16-18(30)2)24-11-8-20(26(32)33)15-23(24)28-25(31)19-6-9-21(27)10-7-19/h3-11,14-15,18H,12-13,16H2,1-2H3,(H,28,31)(H,32,33)/t18-/m0/s1 |
| InChIKey | LTQGMMMVEGJBTI-SFHVURJKSA-N |
| XLogP | 4.80 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |