C22H27N3O3 — CID 99768648
4-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]-3-(propanoylamino)benzoic acid (PubChem CID 99768648) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]-3-(propanoylamino)benzoic acid.
| Compound Name | 4-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]-3-(propanoylamino)benzoic acid |
|---|---|
| PubChem CID | 99768648 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 4-[(3S)-3-methyl-4-(3-methylphenyl)piperazin-1-yl]-3-(propanoylamino)benzoic acid |
| SMILES | CCC(=O)Nc1cc(C(=O)O)ccc1N1CCN(c2cccc(C)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C22H27N3O3/c1-4-21(26)23-19-13-17(22(27)28)8-9-20(19)24-10-11-25(16(3)14-24)18-7-5-6-15(2)12-18/h5-9,12-13,16H,4,10-11,14H2,1-3H3,(H,23,26)(H,27,28)/t16-/m0/s1 |
| InChIKey | TZXMSEDNBCNZCN-INIZCTEOSA-N |
| XLogP | 3.76 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |