C29H32F3N3O6S — CID 146055189
5-[(2,5-dimethylphenyl)sulfonylamino]-2-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146055189) has the molecular formula C29H32F3N3O6S and a molecular weight of 607.65 g/mol. Its IUPAC name is 5-[(2,5-dimethylphenyl)sulfonylamino]-2-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[(2,5-dimethylphenyl)sulfonylamino]-2-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146055189 |
| Molecular Formula | C29H32F3N3O6S |
| Molecular Weight | 607.65 g/mol |
| Exact Mass | 607.20 |
| IUPAC Name | 5-[(2,5-dimethylphenyl)sulfonylamino]-2-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cccc(N2CCN(c3ccc(NS(=O)(=O)c4cc(C)ccc4C)cc3C(=O)O)CC2C)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H31N3O4S.C2HF3O2/c1-18-6-5-7-23(14-18)30-13-12-29(17-21(30)4)25-11-10-22(16-24(25)27(31)32)28-35(33,34)26-15-19(2)8-9-20(26)3;3-2(4,5)1(6)7/h5-11,14-16,21,28H,12-13,17H2,1-4H3,(H,31,32);(H,6,7) |
| InChIKey | PPYUMAULFVWPGN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 127.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.65 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|