C22H27N3O6S — CID 46291611
5-[(2,5-dimethylphenyl)sulfonylamino]-2-(4-ethoxycarbonylpiperazin-1-yl)benzoic acid (PubChem CID 46291611) has the molecular formula C22H27N3O6S and a molecular weight of 461.54 g/mol. Its IUPAC name is 5-[(2,5-dimethylphenyl)sulfonylamino]-2-(4-ethoxycarbonylpiperazin-1-yl)benzoic acid.
| Compound Name | 5-[(2,5-dimethylphenyl)sulfonylamino]-2-(4-ethoxycarbonylpiperazin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 46291611 |
| Molecular Formula | C22H27N3O6S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 5-[(2,5-dimethylphenyl)sulfonylamino]-2-(4-ethoxycarbonylpiperazin-1-yl)benzoic acid |
| SMILES | CCOC(=O)N1CCN(c2ccc(NS(=O)(=O)c3cc(C)ccc3C)cc2C(=O)O)CC1 |
| InChI | InChI=1S/C22H27N3O6S/c1-4-31-22(28)25-11-9-24(10-12-25)19-8-7-17(14-18(19)21(26)27)23-32(29,30)20-13-15(2)5-6-16(20)3/h5-8,13-14,23H,4,9-12H2,1-3H3,(H,26,27) |
| InChIKey | LPHFKTXCVJYGIO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 116.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|