C27H31N3O4S — CID 46291639
2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-[(2,4-dimethylphenyl)sulfonylamino]benzoic acid (PubChem CID 46291639) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-[(2,4-dimethylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-[(2,4-dimethylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 46291639 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-5-[(2,4-dimethylphenyl)sulfonylamino]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(N3CCN(c4cccc(C)c4C)CC3)c(C(=O)O)c2)c(C)c1 |
| InChI | InChI=1S/C27H31N3O4S/c1-18-8-11-26(20(3)16-18)35(33,34)28-22-9-10-25(23(17-22)27(31)32)30-14-12-29(13-15-30)24-7-5-6-19(2)21(24)4/h5-11,16-17,28H,12-15H2,1-4H3,(H,31,32) |
| InChIKey | GCUMAWPBTLGRHS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|