C26H28FN3O4S — CID 50766307
2-[4-(2-fluorophenyl)piperazin-1-yl]-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzoic acid (PubChem CID 50766307) has the molecular formula C26H28FN3O4S and a molecular weight of 497.59 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)piperazin-1-yl]-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 50766307 |
| Molecular Formula | C26H28FN3O4S |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzoic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2ccc(N3CCN(c4ccccc4F)CC3)c(C(=O)O)c2)c(C)c1 |
| InChI | InChI=1S/C26H28FN3O4S/c1-17-14-18(2)25(19(3)15-17)35(33,34)28-20-8-9-23(21(16-20)26(31)32)29-10-12-30(13-11-29)24-7-5-4-6-22(24)27/h4-9,14-16,28H,10-13H2,1-3H3,(H,31,32) |
| InChIKey | VKHJIQVNRKAZEX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|