C25H28N4O4S — CID 50766070
2-(4-pyridin-2-ylpiperazin-1-yl)-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzoic acid (PubChem CID 50766070) has the molecular formula C25H28N4O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is 2-(4-pyridin-2-ylpiperazin-1-yl)-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-(4-pyridin-2-ylpiperazin-1-yl)-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 50766070 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 2-(4-pyridin-2-ylpiperazin-1-yl)-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzoic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2ccc(N3CCN(c4ccccn4)CC3)c(C(=O)O)c2)c(C)c1 |
| InChI | InChI=1S/C25H28N4O4S/c1-17-14-18(2)24(19(3)15-17)34(32,33)27-20-7-8-22(21(16-20)25(30)31)28-10-12-29(13-11-28)23-6-4-5-9-26-23/h4-9,14-16,27H,10-13H2,1-3H3,(H,30,31) |
| InChIKey | DMHBFDZRBGRNLD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|