C28H33N3O3S — CID 42751709
2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-propan-2-yl-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzamide (PubChem CID 42751709) has the molecular formula C28H33N3O3S and a molecular weight of 491.66 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-propan-2-yl-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-propan-2-yl-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 42751709 |
| Molecular Formula | C28H33N3O3S |
| Molecular Weight | 491.66 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-propan-2-yl-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2ccc(N3CCc4ccccc4C3)c(C(=O)NC(C)C)c2)c(C)c1 |
| InChI | InChI=1S/C28H33N3O3S/c1-18(2)29-28(32)25-16-24(30-35(33,34)27-20(4)14-19(3)15-21(27)5)10-11-26(25)31-13-12-22-8-6-7-9-23(22)17-31/h6-11,14-16,18,30H,12-13,17H2,1-5H3,(H,29,32) |
| InChIKey | GSOZJUSZODNLOH-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.66 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|