C28H31N3O3S — CID 1064359
2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-methylpropyl)-5-(2-phenylethenylsulfonylamino)benzamide (PubChem CID 1064359) has the molecular formula C28H31N3O3S and a molecular weight of 489.64 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-methylpropyl)-5-(2-phenylethenylsulfonylamino)benzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-methylpropyl)-5-(2-phenylethenylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 1064359 |
| Molecular Formula | C28H31N3O3S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-methylpropyl)-5-(2-phenylethenylsulfonylamino)benzamide |
| SMILES | CC(C)CNC(=O)c1cc(NS(=O)(=O)C=Cc2ccccc2)ccc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C28H31N3O3S/c1-21(2)19-29-28(32)26-18-25(30-35(33,34)17-15-22-8-4-3-5-9-22)12-13-27(26)31-16-14-23-10-6-7-11-24(23)20-31/h3-13,15,17-18,21,30H,14,16,19-20H2,1-2H3,(H,29,32) |
| InChIKey | ODTBCTLLOZDAAF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|