C26H26FN3O2 — CID 1063756
2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(4-fluorobenzoyl)amino]-N-propan-2-ylbenzamide (PubChem CID 1063756) has the molecular formula C26H26FN3O2 and a molecular weight of 431.51 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(4-fluorobenzoyl)amino]-N-propan-2-ylbenzamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(4-fluorobenzoyl)amino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 1063756 |
| Molecular Formula | C26H26FN3O2 |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(4-fluorobenzoyl)amino]-N-propan-2-ylbenzamide |
| SMILES | CC(C)NC(=O)c1cc(NC(=O)c2ccc(F)cc2)ccc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C26H26FN3O2/c1-17(2)28-26(32)23-15-22(29-25(31)19-7-9-21(27)10-8-19)11-12-24(23)30-14-13-18-5-3-4-6-20(18)16-30/h3-12,15,17H,13-14,16H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | ZFRAAEUPZSSFGT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|