C27H29FN4O2 — CID 4693590
N-butan-2-yl-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2-fluorophenyl)carbamoylamino]benzamide (PubChem CID 4693590) has the molecular formula C27H29FN4O2 and a molecular weight of 460.55 g/mol. Its IUPAC name is N-butan-2-yl-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2-fluorophenyl)carbamoylamino]benzamide.
| Compound Name | N-butan-2-yl-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2-fluorophenyl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 4693590 |
| Molecular Formula | C27H29FN4O2 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | N-butan-2-yl-2-(3,4-dihydro-1H-isoquinolin-2-yl)-5-[(2-fluorophenyl)carbamoylamino]benzamide |
| SMILES | CCC(C)NC(=O)c1cc(NC(=O)Nc2ccccc2F)ccc1N1CCc2ccccc2C1 |
| InChI | InChI=1S/C27H29FN4O2/c1-3-18(2)29-26(33)22-16-21(30-27(34)31-24-11-7-6-10-23(24)28)12-13-25(22)32-15-14-19-8-4-5-9-20(19)17-32/h4-13,16,18H,3,14-15,17H2,1-2H3,(H,29,33)(H2,30,31,34) |
| InChIKey | SEARKAWGOLVJIT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|