C28H28FN3O2 — CID 1063885
N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-4-fluorobenzamide (PubChem CID 1063885) has the molecular formula C28H28FN3O2 and a molecular weight of 457.55 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-4-fluorobenzamide.
| Compound Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 1063885 |
| Molecular Formula | C28H28FN3O2 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-4-fluorobenzamide |
| SMILES | O=C(Nc1ccc(N2CCc3ccccc3C2)c(C(=O)N2CCCCC2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H28FN3O2/c29-23-10-8-21(9-11-23)27(33)30-24-12-13-26(25(18-24)28(34)31-15-4-1-5-16-31)32-17-14-20-6-2-3-7-22(20)19-32/h2-3,6-13,18H,1,4-5,14-17,19H2,(H,30,33) |
| InChIKey | VWFHJFQCFMTVFD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|