C28H28ClN3O2 — CID 3538442
2-chloro-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(pyrrolidine-1-carbonyl)phenyl]-2-phenylacetamide (PubChem CID 3538442) has the molecular formula C28H28ClN3O2 and a molecular weight of 474.00 g/mol. Its IUPAC name is 2-chloro-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(pyrrolidine-1-carbonyl)phenyl]-2-phenylacetamide.
| Compound Name | 2-chloro-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(pyrrolidine-1-carbonyl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 3538442 |
| Molecular Formula | C28H28ClN3O2 |
| Molecular Weight | 474.00 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 2-chloro-N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(pyrrolidine-1-carbonyl)phenyl]-2-phenylacetamide |
| SMILES | O=C(Nc1ccc(N2CCc3ccccc3C2)c(C(=O)N2CCCC2)c1)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C28H28ClN3O2/c29-26(21-9-2-1-3-10-21)27(33)30-23-12-13-25(24(18-23)28(34)31-15-6-7-16-31)32-17-14-20-8-4-5-11-22(20)19-32/h1-5,8-13,18,26H,6-7,14-17,19H2,(H,30,33) |
| InChIKey | JSNCGYHWKJJYPS-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.00 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|