C29H39N3O2 — CID 42751232
N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-2-ethylhexanamide (PubChem CID 42751232) has the molecular formula C29H39N3O2 and a molecular weight of 461.65 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-2-ethylhexanamide.
| Compound Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-2-ethylhexanamide |
|---|---|
| PubChem CID | 42751232 |
| Molecular Formula | C29H39N3O2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]-2-ethylhexanamide |
| SMILES | CCCCC(CC)C(=O)Nc1ccc(N2CCc3ccccc3C2)c(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C29H39N3O2/c1-3-5-11-22(4-2)28(33)30-25-14-15-27(26(20-25)29(34)31-17-9-6-10-18-31)32-19-16-23-12-7-8-13-24(23)21-32/h7-8,12-15,20,22H,3-6,9-11,16-19,21H2,1-2H3,(H,30,33) |
| InChIKey | AMWQYXIOTFTOHE-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|