C31H43N3O2 — CID 42751242
N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]decanamide (PubChem CID 42751242) has the molecular formula C31H43N3O2 and a molecular weight of 489.70 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]decanamide.
| Compound Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]decanamide |
|---|---|
| PubChem CID | 42751242 |
| Molecular Formula | C31H43N3O2 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.34 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(piperidine-1-carbonyl)phenyl]decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(N2CCc3ccccc3C2)c(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C31H43N3O2/c1-2-3-4-5-6-7-9-16-30(35)32-27-17-18-29(28(23-27)31(36)33-20-12-8-13-21-33)34-22-19-25-14-10-11-15-26(25)24-34/h10-11,14-15,17-18,23H,2-9,12-13,16,19-22,24H2,1H3,(H,32,35) |
| InChIKey | IRNKDQZMLUVMCD-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|