C33H48N4O3 — CID 3919832
5-(decanoylamino)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-morpholin-4-ylpropyl)benzamide (PubChem CID 3919832) has the molecular formula C33H48N4O3 and a molecular weight of 548.77 g/mol. Its IUPAC name is 5-(decanoylamino)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-morpholin-4-ylpropyl)benzamide.
| Compound Name | 5-(decanoylamino)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-morpholin-4-ylpropyl)benzamide |
|---|---|
| PubChem CID | 3919832 |
| Molecular Formula | C33H48N4O3 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.37 |
| IUPAC Name | 5-(decanoylamino)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-morpholin-4-ylpropyl)benzamide |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C33H48N4O3/c1-2-3-4-5-6-7-8-14-32(38)35-29-15-16-31(37-20-17-27-12-9-10-13-28(27)26-37)30(25-29)33(39)34-18-11-19-36-21-23-40-24-22-36/h9-10,12-13,15-16,25H,2-8,11,14,17-24,26H2,1H3,(H,34,39)(H,35,38) |
| InChIKey | CGQWCACOZJTCEE-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|