C26H36N4O4S — CID 1064388
N-(2-morpholin-4-ylethyl)-2-pyrrolidin-1-yl-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzamide (PubChem CID 1064388) has the molecular formula C26H36N4O4S and a molecular weight of 500.67 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-2-pyrrolidin-1-yl-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-2-pyrrolidin-1-yl-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 1064388 |
| Molecular Formula | C26H36N4O4S |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-2-pyrrolidin-1-yl-5-[(2,4,6-trimethylphenyl)sulfonylamino]benzamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2ccc(N3CCCC3)c(C(=O)NCCN3CCOCC3)c2)c(C)c1 |
| InChI | InChI=1S/C26H36N4O4S/c1-19-16-20(2)25(21(3)17-19)35(32,33)28-22-6-7-24(30-9-4-5-10-30)23(18-22)26(31)27-8-11-29-12-14-34-15-13-29/h6-7,16-18,28H,4-5,8-15H2,1-3H3,(H,27,31) |
| InChIKey | PHTYSGXLVQFGID-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|