C27H33N5O4S — CID 42751769
N-(3-morpholin-4-ylpropyl)-2-pyrrolidin-1-yl-5-(quinolin-8-ylsulfonylamino)benzamide (PubChem CID 42751769) has the molecular formula C27H33N5O4S and a molecular weight of 523.66 g/mol. Its IUPAC name is N-(3-morpholin-4-ylpropyl)-2-pyrrolidin-1-yl-5-(quinolin-8-ylsulfonylamino)benzamide.
| Compound Name | N-(3-morpholin-4-ylpropyl)-2-pyrrolidin-1-yl-5-(quinolin-8-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 42751769 |
| Molecular Formula | C27H33N5O4S |
| Molecular Weight | 523.66 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | N-(3-morpholin-4-ylpropyl)-2-pyrrolidin-1-yl-5-(quinolin-8-ylsulfonylamino)benzamide |
| SMILES | O=C(NCCCN1CCOCC1)c1cc(NS(=O)(=O)c2cccc3cccnc23)ccc1N1CCCC1 |
| InChI | InChI=1S/C27H33N5O4S/c33-27(29-12-5-13-31-16-18-36-19-17-31)23-20-22(9-10-24(23)32-14-1-2-15-32)30-37(34,35)25-8-3-6-21-7-4-11-28-26(21)25/h3-4,6-11,20,30H,1-2,5,12-19H2,(H,29,33) |
| InChIKey | FKBPLHSWXSIUGW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.66 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|