C23H21FN4O3 — CID 46363069
5-[(2-fluorobenzoyl)amino]-2-(4-pyridin-2-ylpiperazin-1-yl)benzoic acid (PubChem CID 46363069) has the molecular formula C23H21FN4O3 and a molecular weight of 420.44 g/mol. Its IUPAC name is 5-[(2-fluorobenzoyl)amino]-2-(4-pyridin-2-ylpiperazin-1-yl)benzoic acid.
| Compound Name | 5-[(2-fluorobenzoyl)amino]-2-(4-pyridin-2-ylpiperazin-1-yl)benzoic acid |
|---|---|
| PubChem CID | 46363069 |
| Molecular Formula | C23H21FN4O3 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 5-[(2-fluorobenzoyl)amino]-2-(4-pyridin-2-ylpiperazin-1-yl)benzoic acid |
| SMILES | O=C(Nc1ccc(N2CCN(c3ccccn3)CC2)c(C(=O)O)c1)c1ccccc1F |
| InChI | InChI=1S/C23H21FN4O3/c24-19-6-2-1-5-17(19)22(29)26-16-8-9-20(18(15-16)23(30)31)27-11-13-28(14-12-27)21-7-3-4-10-25-21/h1-10,15H,11-14H2,(H,26,29)(H,30,31) |
| InChIKey | AMHBFASXJLPIKN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|