C21H21FN4O3 — CID 46363195
2-[4-(2-cyanoethyl)piperazin-1-yl]-5-[(2-fluorobenzoyl)amino]benzoic acid (PubChem CID 46363195) has the molecular formula C21H21FN4O3 and a molecular weight of 396.42 g/mol. Its IUPAC name is 2-[4-(2-cyanoethyl)piperazin-1-yl]-5-[(2-fluorobenzoyl)amino]benzoic acid.
| Compound Name | 2-[4-(2-cyanoethyl)piperazin-1-yl]-5-[(2-fluorobenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 46363195 |
| Molecular Formula | C21H21FN4O3 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 2-[4-(2-cyanoethyl)piperazin-1-yl]-5-[(2-fluorobenzoyl)amino]benzoic acid |
| SMILES | N#CCCN1CCN(c2ccc(NC(=O)c3ccccc3F)cc2C(=O)O)CC1 |
| InChI | InChI=1S/C21H21FN4O3/c22-18-5-2-1-4-16(18)20(27)24-15-6-7-19(17(14-15)21(28)29)26-12-10-25(11-13-26)9-3-8-23/h1-2,4-7,14H,3,9-13H2,(H,24,27)(H,28,29) |
| InChIKey | MHQQEKYFDOEZRV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|