C21H27F3N4O5 — CID 146061023
2-[4-(2-cyanoethyl)piperazin-1-yl]-5-(pentanoylamino)benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146061023) has the molecular formula C21H27F3N4O5 and a molecular weight of 472.46 g/mol. Its IUPAC name is 2-[4-(2-cyanoethyl)piperazin-1-yl]-5-(pentanoylamino)benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-(2-cyanoethyl)piperazin-1-yl]-5-(pentanoylamino)benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146061023 |
| Molecular Formula | C21H27F3N4O5 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 2-[4-(2-cyanoethyl)piperazin-1-yl]-5-(pentanoylamino)benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCCCC(=O)Nc1ccc(N2CCN(CCC#N)CC2)c(C(=O)O)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H26N4O3.C2HF3O2/c1-2-3-5-18(24)21-15-6-7-17(16(14-15)19(25)26)23-12-10-22(11-13-23)9-4-8-20;3-2(4,5)1(6)7/h6-7,14H,2-5,9-13H2,1H3,(H,21,24)(H,25,26);(H,6,7) |
| InChIKey | VILQHCAJGLONBC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 133.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|