C20H20Cl2N4O4S — CID 46291702
2-[4-(2-cyanoethyl)piperazin-1-yl]-5-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid (PubChem CID 46291702) has the molecular formula C20H20Cl2N4O4S and a molecular weight of 483.38 g/mol. Its IUPAC name is 2-[4-(2-cyanoethyl)piperazin-1-yl]-5-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid.
| Compound Name | 2-[4-(2-cyanoethyl)piperazin-1-yl]-5-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 46291702 |
| Molecular Formula | C20H20Cl2N4O4S |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 482.06 |
| IUPAC Name | 2-[4-(2-cyanoethyl)piperazin-1-yl]-5-[(3,4-dichlorophenyl)sulfonylamino]benzoic acid |
| SMILES | N#CCCN1CCN(c2ccc(NS(=O)(=O)c3ccc(Cl)c(Cl)c3)cc2C(=O)O)CC1 |
| InChI | InChI=1S/C20H20Cl2N4O4S/c21-17-4-3-15(13-18(17)22)31(29,30)24-14-2-5-19(16(12-14)20(27)28)26-10-8-25(9-11-26)7-1-6-23/h2-5,12-13,24H,1,7-11H2,(H,27,28) |
| InChIKey | VTRAEXFDNMYUQA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|