C21H26ClN5O3 — CID 50807082
2-[4-(6-chloropyridazin-3-yl)-1,4-diazepan-1-yl]-5-(pentanoylamino)benzoic acid (PubChem CID 50807082) has the molecular formula C21H26ClN5O3 and a molecular weight of 431.92 g/mol. Its IUPAC name is 2-[4-(6-chloropyridazin-3-yl)-1,4-diazepan-1-yl]-5-(pentanoylamino)benzoic acid.
| Compound Name | 2-[4-(6-chloropyridazin-3-yl)-1,4-diazepan-1-yl]-5-(pentanoylamino)benzoic acid |
|---|---|
| PubChem CID | 50807082 |
| Molecular Formula | C21H26ClN5O3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 2-[4-(6-chloropyridazin-3-yl)-1,4-diazepan-1-yl]-5-(pentanoylamino)benzoic acid |
| SMILES | CCCCC(=O)Nc1ccc(N2CCCN(c3ccc(Cl)nn3)CC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C21H26ClN5O3/c1-2-3-5-20(28)23-15-6-7-17(16(14-15)21(29)30)26-10-4-11-27(13-12-26)19-9-8-18(22)24-25-19/h6-9,14H,2-5,10-13H2,1H3,(H,23,28)(H,29,30) |
| InChIKey | VBMBRQDADKDTQT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|