C23H29FN4O5S — CID 50766248
5-[(5-fluoro-2-methylphenyl)sulfonylamino]-2-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazin-1-yl]benzoic acid (PubChem CID 50766248) has the molecular formula C23H29FN4O5S and a molecular weight of 492.57 g/mol. Its IUPAC name is 5-[(5-fluoro-2-methylphenyl)sulfonylamino]-2-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazin-1-yl]benzoic acid.
| Compound Name | 5-[(5-fluoro-2-methylphenyl)sulfonylamino]-2-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 50766248 |
| Molecular Formula | C23H29FN4O5S |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 5-[(5-fluoro-2-methylphenyl)sulfonylamino]-2-[4-[2-oxo-2-(propan-2-ylamino)ethyl]piperazin-1-yl]benzoic acid |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)Nc1ccc(N2CCN(CC(=O)NC(C)C)CC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C23H29FN4O5S/c1-15(2)25-22(29)14-27-8-10-28(11-9-27)20-7-6-18(13-19(20)23(30)31)26-34(32,33)21-12-17(24)5-4-16(21)3/h4-7,12-13,15,26H,8-11,14H2,1-3H3,(H,25,29)(H,30,31) |
| InChIKey | KIQRWLGDYIRPPQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|