C23H32N4O3S — CID 92895458
N-[(2R)-butan-2-yl]-5-[(2,5-dimethylphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide (PubChem CID 92895458) has the molecular formula C23H32N4O3S and a molecular weight of 444.60 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-5-[(2,5-dimethylphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide.
| Compound Name | N-[(2R)-butan-2-yl]-5-[(2,5-dimethylphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 92895458 |
| Molecular Formula | C23H32N4O3S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N-[(2R)-butan-2-yl]-5-[(2,5-dimethylphenyl)sulfonylamino]-2-piperazin-1-ylbenzamide |
| SMILES | CC[C@@H](C)NC(=O)c1cc(NS(=O)(=O)c2cc(C)ccc2C)ccc1N1CCNCC1 |
| InChI | InChI=1S/C23H32N4O3S/c1-5-18(4)25-23(28)20-15-19(8-9-21(20)27-12-10-24-11-13-27)26-31(29,30)22-14-16(2)6-7-17(22)3/h6-9,14-15,18,24,26H,5,10-13H2,1-4H3,(H,25,28)/t18-/m1/s1 |
| InChIKey | MBMWIJBHODXZCC-GOSISDBHSA-N |
| XLogP | 3.04 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|