C23H27ClF4N4O5S — CID 163337370
N-butan-2-yl-5-[(3-chloro-4-fluorophenyl)sulfonylamino]-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid (PubChem CID 163337370) has the molecular formula C23H27ClF4N4O5S and a molecular weight of 583.00 g/mol. Its IUPAC name is N-butan-2-yl-5-[(3-chloro-4-fluorophenyl)sulfonylamino]-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-butan-2-yl-5-[(3-chloro-4-fluorophenyl)sulfonylamino]-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 163337370 |
| Molecular Formula | C23H27ClF4N4O5S |
| Molecular Weight | 583.00 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | N-butan-2-yl-5-[(3-chloro-4-fluorophenyl)sulfonylamino]-2-piperazin-1-ylbenzamide;2,2,2-trifluoroacetic acid |
| SMILES | CCC(C)NC(=O)c1cc(NS(=O)(=O)c2ccc(F)c(Cl)c2)ccc1N1CCNCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H26ClFN4O3S.C2HF3O2/c1-3-14(2)25-21(28)17-12-15(4-7-20(17)27-10-8-24-9-11-27)26-31(29,30)16-5-6-19(23)18(22)13-16;3-2(4,5)1(6)7/h4-7,12-14,24,26H,3,8-11H2,1-2H3,(H,25,28);(H,6,7) |
| InChIKey | QUYNBGKDFHVXBS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.00 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|