C25H36N4O3S — CID 46379635
N-butan-2-yl-5-[[4-(2-methylpropyl)phenyl]sulfonylamino]-2-piperazin-1-ylbenzamide (PubChem CID 46379635) has the molecular formula C25H36N4O3S and a molecular weight of 472.66 g/mol. Its IUPAC name is N-butan-2-yl-5-[[4-(2-methylpropyl)phenyl]sulfonylamino]-2-piperazin-1-ylbenzamide.
| Compound Name | N-butan-2-yl-5-[[4-(2-methylpropyl)phenyl]sulfonylamino]-2-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 46379635 |
| Molecular Formula | C25H36N4O3S |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | N-butan-2-yl-5-[[4-(2-methylpropyl)phenyl]sulfonylamino]-2-piperazin-1-ylbenzamide |
| SMILES | CCC(C)NC(=O)c1cc(NS(=O)(=O)c2ccc(CC(C)C)cc2)ccc1N1CCNCC1 |
| InChI | InChI=1S/C25H36N4O3S/c1-5-19(4)27-25(30)23-17-21(8-11-24(23)29-14-12-26-13-15-29)28-33(31,32)22-9-6-20(7-10-22)16-18(2)3/h6-11,17-19,26,28H,5,12-16H2,1-4H3,(H,27,30) |
| InChIKey | NNZYSJQQKUFIAO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|