C20H26ClN5O3S — CID 53010553
N-butan-2-yl-5-[(4-chlorophenyl)sulfonylamino]-2-piperazin-1-ylpyridine-3-carboxamide (PubChem CID 53010553) has the molecular formula C20H26ClN5O3S and a molecular weight of 451.98 g/mol. Its IUPAC name is N-butan-2-yl-5-[(4-chlorophenyl)sulfonylamino]-2-piperazin-1-ylpyridine-3-carboxamide.
| Compound Name | N-butan-2-yl-5-[(4-chlorophenyl)sulfonylamino]-2-piperazin-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 53010553 |
| Molecular Formula | C20H26ClN5O3S |
| Molecular Weight | 451.98 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-butan-2-yl-5-[(4-chlorophenyl)sulfonylamino]-2-piperazin-1-ylpyridine-3-carboxamide |
| SMILES | CCC(C)NC(=O)c1cc(NS(=O)(=O)c2ccc(Cl)cc2)cnc1N1CCNCC1 |
| InChI | InChI=1S/C20H26ClN5O3S/c1-3-14(2)24-20(27)18-12-16(13-23-19(18)26-10-8-22-9-11-26)25-30(28,29)17-6-4-15(21)5-7-17/h4-7,12-14,22,25H,3,8-11H2,1-2H3,(H,24,27) |
| InChIKey | VMKJYXNJROLAKA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.98 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |