C22H29N5O4S — CID 53108226
N-cyclopentyl-5-[(4-methoxyphenyl)sulfonylamino]-2-piperazin-1-ylpyridine-3-carboxamide (PubChem CID 53108226) has the molecular formula C22H29N5O4S and a molecular weight of 459.57 g/mol. Its IUPAC name is N-cyclopentyl-5-[(4-methoxyphenyl)sulfonylamino]-2-piperazin-1-ylpyridine-3-carboxamide.
| Compound Name | N-cyclopentyl-5-[(4-methoxyphenyl)sulfonylamino]-2-piperazin-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 53108226 |
| Molecular Formula | C22H29N5O4S |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | N-cyclopentyl-5-[(4-methoxyphenyl)sulfonylamino]-2-piperazin-1-ylpyridine-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cnc(N3CCNCC3)c(C(=O)NC3CCCC3)c2)cc1 |
| InChI | InChI=1S/C22H29N5O4S/c1-31-18-6-8-19(9-7-18)32(29,30)26-17-14-20(22(28)25-16-4-2-3-5-16)21(24-15-17)27-12-10-23-11-13-27/h6-9,14-16,23,26H,2-5,10-13H2,1H3,(H,25,28) |
| InChIKey | MSKCMNKBNYQCLP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |