C23H31N5O4S — CID 53108396
N-cyclohexyl-5-[(3-methoxyphenyl)sulfonylamino]-2-piperazin-1-ylpyridine-3-carboxamide (PubChem CID 53108396) has the molecular formula C23H31N5O4S and a molecular weight of 473.60 g/mol. Its IUPAC name is N-cyclohexyl-5-[(3-methoxyphenyl)sulfonylamino]-2-piperazin-1-ylpyridine-3-carboxamide.
| Compound Name | N-cyclohexyl-5-[(3-methoxyphenyl)sulfonylamino]-2-piperazin-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 53108396 |
| Molecular Formula | C23H31N5O4S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | N-cyclohexyl-5-[(3-methoxyphenyl)sulfonylamino]-2-piperazin-1-ylpyridine-3-carboxamide |
| SMILES | COc1cccc(S(=O)(=O)Nc2cnc(N3CCNCC3)c(C(=O)NC3CCCCC3)c2)c1 |
| InChI | InChI=1S/C23H31N5O4S/c1-32-19-8-5-9-20(15-19)33(30,31)27-18-14-21(23(29)26-17-6-3-2-4-7-17)22(25-16-18)28-12-10-24-11-13-28/h5,8-9,14-17,24,27H,2-4,6-7,10-13H2,1H3,(H,26,29) |
| InChIKey | WSKVTQBTRJJIGU-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |